C21H30O2 — CID 101157212
2-[[(1R,2S,5R,8S)-4,4,8-trimethyl-1-tricyclo[6.3.1.02,5]dodecanyl]oxy]phenol (PubChem CID 101157212) has the molecular formula C21H30O2 and a molecular weight of 314.47 g/mol. Its IUPAC name is 2-[[(1R,2S,5R,8S)-4,4,8-trimethyl-1-tricyclo[6.3.1.02,5]dodecanyl]oxy]phenol.
| Compound Name | 2-[[(1R,2S,5R,8S)-4,4,8-trimethyl-1-tricyclo[6.3.1.02,5]dodecanyl]oxy]phenol |
|---|---|
| PubChem CID | 101157212 |
| Molecular Formula | C21H30O2 |
| Molecular Weight | 314.47 g/mol |
| Exact Mass | 314.22 |
| IUPAC Name | 2-[[(1R,2S,5R,8S)-4,4,8-trimethyl-1-tricyclo[6.3.1.02,5]dodecanyl]oxy]phenol |
| SMILES | CC1(C)C[C@H]2[C@H]1CC[C@]1(C)CCC[C@@]2(Oc2ccccc2O)C1 |
| InChI | InChI=1S/C21H30O2/c1-19(2)13-16-15(19)9-12-20(3)10-6-11-21(16,14-20)23-18-8-5-4-7-17(18)22/h4-5,7-8,15-16,22H,6,9-14H2,1-3H3/t15-,16+,20+,21-/m1/s1 |
| InChIKey | NGKYFDOEIZWCNC-QMKUDKLTSA-N |
| XLogP | 5.55 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.47 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |