About 3-ethenyl-6-(methoxymethoxy)-3-methylocta-1,7-diene
3-ethenyl-6-(methoxymethoxy)-3-methylocta-1,7-diene (PubChem CID 101158332) has the molecular formula C13H22O2
and a molecular weight of 210.32 g/mol. Its IUPAC name is 3-ethenyl-6-(methoxymethoxy)-3-methylocta-1,7-diene.
Molecular Properties
| Compound Name | 3-ethenyl-6-(methoxymethoxy)-3-methylocta-1,7-diene |
| PubChem CID | 101158332 |
| Molecular Formula | C13H22O2 |
| Molecular Weight | 210.32 g/mol |
| Exact Mass | 210.16 |
| IUPAC Name | 3-ethenyl-6-(methoxymethoxy)-3-methylocta-1,7-diene |
| SMILES | C=CC(CCC(C)(C=C)C=C)OCOC |
| InChI | InChI=1S/C13H22O2/c1-6-12(15-11-14-5)9-10-13(4,7-2)8-3/h6-8,12H,1-3,9-11H2,4-5H3 |
| InChIKey | WUBGYWMKJKTOON-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.32 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-ethenyl-6-(methoxymethoxy)-3-methylocta-1,7-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethenyl-6-(methoxymethoxy)-3-methylocta-1,7-diene?
The IUPAC name of 3-ethenyl-6-(methoxymethoxy)-3-methylocta-1,7-diene (CID 101158332) is 3-ethenyl-6-(methoxymethoxy)-3-methylocta-1,7-diene.
What is the SMILES notation for 3-ethenyl-6-(methoxymethoxy)-3-methylocta-1,7-diene?
The canonical SMILES for 3-ethenyl-6-(methoxymethoxy)-3-methylocta-1,7-diene is C=CC(CCC(C)(C=C)C=C)OCOC.
What is the InChIKey of 3-ethenyl-6-(methoxymethoxy)-3-methylocta-1,7-diene?
The InChIKey is WUBGYWMKJKTOON-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22O2/c1-6-12(15-11-14-5)9-10-13(4,7-2)8-3/h6-8,12H,1-3,9-11H2,4-5H3.
What are the key properties of 3-ethenyl-6-(methoxymethoxy)-3-methylocta-1,7-diene?
3-ethenyl-6-(methoxymethoxy)-3-methylocta-1,7-diene has a molecular weight of 210.32 g/mol, XLogP of 3.32, 9 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethenyl-6-(methoxymethoxy)-3-methylocta-1,7-diene is sourced from PubChem (CID 101158332), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).