C19H30O3SSi — CID 101158409
ethyl (2R,3R)-2-phenyl-3-triethylsilyl-1,4-oxathiane-3-carboxylate (PubChem CID 101158409) has the molecular formula C19H30O3SSi and a molecular weight of 366.60 g/mol. Its IUPAC name is ethyl (2R,3R)-2-phenyl-3-triethylsilyl-1,4-oxathiane-3-carboxylate.
| Compound Name | ethyl (2R,3R)-2-phenyl-3-triethylsilyl-1,4-oxathiane-3-carboxylate |
|---|---|
| PubChem CID | 101158409 |
| Molecular Formula | C19H30O3SSi |
| Molecular Weight | 366.60 g/mol |
| Exact Mass | 366.17 |
| IUPAC Name | ethyl (2R,3R)-2-phenyl-3-triethylsilyl-1,4-oxathiane-3-carboxylate |
| SMILES | CCOC(=O)[C@]1([Si](CC)(CC)CC)SCCO[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C19H30O3SSi/c1-5-21-18(20)19(24(6-2,7-3)8-4)17(22-14-15-23-19)16-12-10-9-11-13-16/h9-13,17H,5-8,14-15H2,1-4H3/t17-,19+/m1/s1 |
| InChIKey | JXBZUBSVMGNZCJ-MJGOQNOKSA-N |
| XLogP | 4.84 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.60 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|