C11H18O7 — CID 101158689
[(2R,3S,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)-5-methoxyoxolan-2-yl]methyl 2-methylprop-2-enoate (PubChem CID 101158689) has the molecular formula C11H18O7 and a molecular weight of 262.26 g/mol. Its IUPAC name is [(2R,3S,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)-5-methoxyoxolan-2-yl]methyl 2-methylprop-2-enoate.
| Compound Name | [(2R,3S,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)-5-methoxyoxolan-2-yl]methyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 101158689 |
| Molecular Formula | C11H18O7 |
| Molecular Weight | 262.26 g/mol |
| Exact Mass | 262.11 |
| IUPAC Name | [(2R,3S,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)-5-methoxyoxolan-2-yl]methyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC[C@H]1O[C@@](CO)(OC)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C11H18O7/c1-6(2)10(15)17-4-7-8(13)9(14)11(5-12,16-3)18-7/h7-9,12-14H,1,4-5H2,2-3H3/t7-,8-,9+,11-/m1/s1 |
| InChIKey | QWWSWGKQECAZRF-SDNRWEOFSA-N |
| XLogP | -1.44 |
| TPSA | 105.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.26 |
| LogP ≤ 5 | -1.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|