C13H14O3 — CID 101158783
(3S,4R)-3-methyl-4-propanoyl-3,4-dihydrochromen-2-one (PubChem CID 101158783) has the molecular formula C13H14O3 and a molecular weight of 218.25 g/mol. Its IUPAC name is (3S,4R)-3-methyl-4-propanoyl-3,4-dihydrochromen-2-one.
| Compound Name | (3S,4R)-3-methyl-4-propanoyl-3,4-dihydrochromen-2-one |
|---|---|
| PubChem CID | 101158783 |
| Molecular Formula | C13H14O3 |
| Molecular Weight | 218.25 g/mol |
| Exact Mass | 218.09 |
| IUPAC Name | (3S,4R)-3-methyl-4-propanoyl-3,4-dihydrochromen-2-one |
| SMILES | CCC(=O)[C@H]1c2ccccc2OC(=O)[C@H]1C |
| InChI | InChI=1S/C13H14O3/c1-3-10(14)12-8(2)13(15)16-11-7-5-4-6-9(11)12/h4-8,12H,3H2,1-2H3/t8-,12+/m0/s1 |
| InChIKey | JIENMYRLPMQVTM-QPUJVOFHSA-N |
| XLogP | 2.30 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.25 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|