C20H17NO2 — CID 101159080
(3R)-3-[(S)-hydroxy(naphthalen-1-yl)methyl]-2-methyl-3H-isoindol-1-one (PubChem CID 101159080) has the molecular formula C20H17NO2 and a molecular weight of 303.36 g/mol. Its IUPAC name is (3R)-3-[(S)-hydroxy(naphthalen-1-yl)methyl]-2-methyl-3H-isoindol-1-one.
| Compound Name | (3R)-3-[(S)-hydroxy(naphthalen-1-yl)methyl]-2-methyl-3H-isoindol-1-one |
|---|---|
| PubChem CID | 101159080 |
| Molecular Formula | C20H17NO2 |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.13 |
| IUPAC Name | (3R)-3-[(S)-hydroxy(naphthalen-1-yl)methyl]-2-methyl-3H-isoindol-1-one |
| SMILES | CN1C(=O)c2ccccc2[C@@H]1[C@@H](O)c1cccc2ccccc12 |
| InChI | InChI=1S/C20H17NO2/c1-21-18(15-10-4-5-11-17(15)20(21)23)19(22)16-12-6-8-13-7-2-3-9-14(13)16/h2-12,18-19,22H,1H3/t18-,19+/m1/s1 |
| InChIKey | GIVLVAIZNUJBHZ-MOPGFXCFSA-N |
| XLogP | 3.70 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |