C6H4N6O6 — CID 101159181
4,6-dinitro-9,10-dioxa-1,8-diazatricyclo[6.1.1.02,7]deca-2,4,6-triene-3,5-diamine (PubChem CID 101159181) has the molecular formula C6H4N6O6 and a molecular weight of 256.13 g/mol. Its IUPAC name is 4,6-dinitro-9,10-dioxa-1,8-diazatricyclo[6.1.1.02,7]deca-2,4,6-triene-3,5-diamine.
| Compound Name | 4,6-dinitro-9,10-dioxa-1,8-diazatricyclo[6.1.1.02,7]deca-2,4,6-triene-3,5-diamine |
|---|---|
| PubChem CID | 101159181 |
| Molecular Formula | C6H4N6O6 |
| Molecular Weight | 256.13 g/mol |
| Exact Mass | 256.02 |
| IUPAC Name | 4,6-dinitro-9,10-dioxa-1,8-diazatricyclo[6.1.1.02,7]deca-2,4,6-triene-3,5-diamine |
| SMILES | Nc1c2c(c([N+](=O)[O-])c(N)c1[N+](=O)[O-])N1ON2O1 |
| InChI | InChI=1S/C6H4N6O6/c7-1-3(9(13)14)2(8)5-6(4(1)10(15)16)12-17-11(5)18-12/h7-8H2 |
| InChIKey | PVSZZHWDBHTBJH-UHFFFAOYSA-N |
| XLogP | 0.00 |
| TPSA | 163.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.13 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|