C26H18F26O2 — CID 101159211
(1,1,1,2,2,3,3,4,4,5,5,6,6,12,12,13,13,14,14,15,15,16,16,17,17,17-hexacosafluoro-9-methylheptadecan-9-yl) 2-phenylacetate (PubChem CID 101159211) has the molecular formula C26H18F26O2 and a molecular weight of 856.38 g/mol. Its IUPAC name is (1,1,1,2,2,3,3,4,4,5,5,6,6,12,12,13,13,14,14,15,15,16,16,17,17,17-hexacosafluoro-9-methylheptadecan-9-yl) 2-phenylacetate.
| Compound Name | (1,1,1,2,2,3,3,4,4,5,5,6,6,12,12,13,13,14,14,15,15,16,16,17,17,17-hexacosafluoro-9-methylheptadecan-9-yl) 2-phenylacetate |
|---|---|
| PubChem CID | 101159211 |
| Molecular Formula | C26H18F26O2 |
| Molecular Weight | 856.38 g/mol |
| Exact Mass | 856.09 |
| IUPAC Name | (1,1,1,2,2,3,3,4,4,5,5,6,6,12,12,13,13,14,14,15,15,16,16,17,17,17-hexacosafluoro-9-methylheptadecan-9-yl) 2-phenylacetate |
| SMILES | CC(CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)(CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)OC(=O)Cc1ccccc1 |
| InChI | InChI=1S/C26H18F26O2/c1-14(54-13(53)11-12-5-3-2-4-6-12,7-9-15(27,28)17(31,32)19(35,36)21(39,40)23(43,44)25(47,48)49)8-10-16(29,30)18(33,34)20(37,38)22(41,42)24(45,46)26(50,51)52/h2-6H,7-11H2,1H3 |
| InChIKey | SYWYJWFOPYIRRK-UHFFFAOYSA-N |
| XLogP | 11.57 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 856.38 |
| LogP ≤ 5 | 11.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|