C13H24O6 — CID 101159526
(3R,5S,6S)-3-[(1R)-1-hydroxy-2,2-dimethylpropyl]-5,6-dimethoxy-5,6-dimethyl-1,4-dioxan-2-one (PubChem CID 101159526) has the molecular formula C13H24O6 and a molecular weight of 276.33 g/mol. Its IUPAC name is (3R,5S,6S)-3-[(1R)-1-hydroxy-2,2-dimethylpropyl]-5,6-dimethoxy-5,6-dimethyl-1,4-dioxan-2-one.
| Compound Name | (3R,5S,6S)-3-[(1R)-1-hydroxy-2,2-dimethylpropyl]-5,6-dimethoxy-5,6-dimethyl-1,4-dioxan-2-one |
|---|---|
| PubChem CID | 101159526 |
| Molecular Formula | C13H24O6 |
| Molecular Weight | 276.33 g/mol |
| Exact Mass | 276.16 |
| IUPAC Name | (3R,5S,6S)-3-[(1R)-1-hydroxy-2,2-dimethylpropyl]-5,6-dimethoxy-5,6-dimethyl-1,4-dioxan-2-one |
| SMILES | CO[C@@]1(C)OC(=O)[C@@H]([C@H](O)C(C)(C)C)O[C@]1(C)OC |
| InChI | InChI=1S/C13H24O6/c1-11(2,3)9(14)8-10(15)19-13(5,17-7)12(4,16-6)18-8/h8-9,14H,1-7H3/t8-,9+,12+,13+/m1/s1 |
| InChIKey | VMFRNQRDDGPGBV-PSJXJDHFSA-N |
| XLogP | 1.06 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.33 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |