C19H29NS — CID 101160081
(2R)-N-(2-tert-butylphenyl)-N,2,3,3-tetramethylpent-4-enethioamide (PubChem CID 101160081) has the molecular formula C19H29NS and a molecular weight of 303.52 g/mol. Its IUPAC name is (2R)-N-(2-tert-butylphenyl)-N,2,3,3-tetramethylpent-4-enethioamide.
| Compound Name | (2R)-N-(2-tert-butylphenyl)-N,2,3,3-tetramethylpent-4-enethioamide |
|---|---|
| PubChem CID | 101160081 |
| Molecular Formula | C19H29NS |
| Molecular Weight | 303.52 g/mol |
| Exact Mass | 303.20 |
| IUPAC Name | (2R)-N-(2-tert-butylphenyl)-N,2,3,3-tetramethylpent-4-enethioamide |
| SMILES | C=CC(C)(C)[C@@H](C)C(=S)N(C)c1ccccc1C(C)(C)C |
| InChI | InChI=1S/C19H29NS/c1-9-19(6,7)14(2)17(21)20(8)16-13-11-10-12-15(16)18(3,4)5/h9-14H,1H2,2-8H3/t14-/m0/s1 |
| InChIKey | KFJCBRMTFBYIAD-AWEZNQCLSA-N |
| XLogP | 5.60 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.52 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|