C21H19N5O6S — CID 10116042
N-hydroxy-4-[(4-methoxyphenyl)sulfonyl-(pyridin-3-ylmethyl)amino]-3-methyl-[1,2]oxazolo[5,4-b]pyridine-5-carboxamide (PubChem CID 10116042) has the molecular formula C21H19N5O6S and a molecular weight of 469.48 g/mol. Its IUPAC name is N-hydroxy-4-[(4-methoxyphenyl)sulfonyl-(pyridin-3-ylmethyl)amino]-3-methyl-[1,2]oxazolo[5,4-b]pyridine-5-carboxamide.
| Compound Name | N-hydroxy-4-[(4-methoxyphenyl)sulfonyl-(pyridin-3-ylmethyl)amino]-3-methyl-[1,2]oxazolo[5,4-b]pyridine-5-carboxamide |
|---|---|
| PubChem CID | 10116042 |
| Molecular Formula | C21H19N5O6S |
| Molecular Weight | 469.48 g/mol |
| Exact Mass | 469.11 |
| IUPAC Name | N-hydroxy-4-[(4-methoxyphenyl)sulfonyl-(pyridin-3-ylmethyl)amino]-3-methyl-[1,2]oxazolo[5,4-b]pyridine-5-carboxamide |
| SMILES | COc1ccc(S(=O)(=O)N(Cc2cccnc2)c2c(C(=O)NO)cnc3onc(C)c23)cc1 |
| InChI | InChI=1S/C21H19N5O6S/c1-13-18-19(17(20(27)24-28)11-23-21(18)32-25-13)26(12-14-4-3-9-22-10-14)33(29,30)16-7-5-15(31-2)6-8-16/h3-11,28H,12H2,1-2H3,(H,24,27) |
| InChIKey | ZZVSRSRVYMQUCW-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 147.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.48 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|