C24H24BrNO4 — CID 10116090
2-[[1-[(4-hydroxyphenyl)methyl]pyridin-1-ium-4-yl]methyl]-5,6-dimethoxy-2,3-dihydroinden-1-one bromide (PubChem CID 10116090) has the molecular formula C24H24BrNO4 and a molecular weight of 470.36 g/mol. Its IUPAC name is 2-[[1-[(4-hydroxyphenyl)methyl]pyridin-1-ium-4-yl]methyl]-5,6-dimethoxy-2,3-dihydroinden-1-one bromide.
| Compound Name | 2-[[1-[(4-hydroxyphenyl)methyl]pyridin-1-ium-4-yl]methyl]-5,6-dimethoxy-2,3-dihydroinden-1-one bromide |
|---|---|
| PubChem CID | 10116090 |
| Molecular Formula | C24H24BrNO4 |
| Molecular Weight | 470.36 g/mol |
| Exact Mass | 469.09 |
| IUPAC Name | 2-[[1-[(4-hydroxyphenyl)methyl]pyridin-1-ium-4-yl]methyl]-5,6-dimethoxy-2,3-dihydroinden-1-one bromide |
| SMILES | COc1cc2c(cc1OC)C(=O)C(Cc1cc[n+](Cc3ccc(O)cc3)cc1)C2.[Br-] |
| InChI | InChI=1S/C24H23NO4.BrH/c1-28-22-13-18-12-19(24(27)21(18)14-23(22)29-2)11-16-7-9-25(10-8-16)15-17-3-5-20(26)6-4-17;/h3-10,13-14,19H,11-12,15H2,1-2H3;1H |
| InChIKey | HNMYHBQYNDGHHW-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 59.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.36 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|