C9H17ClO — CID 101161058
trans-(1S,5S)-5-chloro-1,3,3-trimethylcyclohexan-1-ol (PubChem CID 101161058) has the molecular formula C9H17ClO and a molecular weight of 176.69 g/mol. Its IUPAC name is trans-(1S,5S)-5-chloro-1,3,3-trimethylcyclohexan-1-ol.
| Compound Name | trans-(1S,5S)-5-chloro-1,3,3-trimethylcyclohexan-1-ol |
|---|---|
| PubChem CID | 101161058 |
| Molecular Formula | C9H17ClO |
| Molecular Weight | 176.69 g/mol |
| Exact Mass | 176.10 |
| IUPAC Name | trans-(1S,5S)-5-chloro-1,3,3-trimethylcyclohexan-1-ol |
| SMILES | CC1(C)C[C@H](Cl)C[C@@](C)(O)C1 |
| InChI | InChI=1S/C9H17ClO/c1-8(2)4-7(10)5-9(3,11)6-8/h7,11H,4-6H2,1-3H3/t7-,9+/m0/s1 |
| InChIKey | HRLCDGKWOFYMOX-IONNQARKSA-N |
| XLogP | 2.55 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.69 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|