C15H20O6 — CID 101161072
(3R,5R)-5-[(3S)-1,4-dioxaspiro[4.5]decan-3-yl]-3-hydroxy-3-prop-2-enyloxolane-2,4-dione (PubChem CID 101161072) has the molecular formula C15H20O6 and a molecular weight of 296.32 g/mol. Its IUPAC name is (3R,5R)-5-[(3S)-1,4-dioxaspiro[4.5]decan-3-yl]-3-hydroxy-3-prop-2-enyloxolane-2,4-dione.
| Compound Name | (3R,5R)-5-[(3S)-1,4-dioxaspiro[4.5]decan-3-yl]-3-hydroxy-3-prop-2-enyloxolane-2,4-dione |
|---|---|
| PubChem CID | 101161072 |
| Molecular Formula | C15H20O6 |
| Molecular Weight | 296.32 g/mol |
| Exact Mass | 296.13 |
| IUPAC Name | (3R,5R)-5-[(3S)-1,4-dioxaspiro[4.5]decan-3-yl]-3-hydroxy-3-prop-2-enyloxolane-2,4-dione |
| SMILES | C=CC[C@]1(O)C(=O)O[C@H]([C@@H]2COC3(CCCCC3)O2)C1=O |
| InChI | InChI=1S/C15H20O6/c1-2-6-15(18)12(16)11(20-13(15)17)10-9-19-14(21-10)7-4-3-5-8-14/h2,10-11,18H,1,3-9H2/t10-,11+,15+/m0/s1 |
| InChIKey | NIYPXJPTYHHCGF-FIXISWKDSA-N |
| XLogP | 0.86 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.32 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|