C16H24O6S — CID 101161089
(2R,3S,4S,5R,6R)-2-(benzenesulfinyl)-3,4,5-trimethoxy-6-(methoxymethyl)oxane (PubChem CID 101161089) has the molecular formula C16H24O6S and a molecular weight of 344.43 g/mol. Its IUPAC name is (2R,3S,4S,5R,6R)-2-(benzenesulfinyl)-3,4,5-trimethoxy-6-(methoxymethyl)oxane.
| Compound Name | (2R,3S,4S,5R,6R)-2-(benzenesulfinyl)-3,4,5-trimethoxy-6-(methoxymethyl)oxane |
|---|---|
| PubChem CID | 101161089 |
| Molecular Formula | C16H24O6S |
| Molecular Weight | 344.43 g/mol |
| Exact Mass | 344.13 |
| IUPAC Name | (2R,3S,4S,5R,6R)-2-(benzenesulfinyl)-3,4,5-trimethoxy-6-(methoxymethyl)oxane |
| SMILES | COC[C@H]1O[C@H](S(=O)c2ccccc2)[C@@H](OC)[C@@H](OC)[C@@H]1OC |
| InChI | InChI=1S/C16H24O6S/c1-18-10-12-13(19-2)14(20-3)15(21-4)16(22-12)23(17)11-8-6-5-7-9-11/h5-9,12-16H,10H2,1-4H3/t12-,13-,14+,15+,16-,23?/m1/s1 |
| InChIKey | QOSRDJGTZGPDCZ-XDVLKZDYSA-N |
| XLogP | 1.21 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.43 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |