C34H22O2S — CID 101161450
3,13-diphenyl-8λ6-thiahexacyclo[13.7.1.02,14.04,12.06,10.019,23]tricosa-1(22),2,4(12),5,10,13,15,17,19(23),20-decaene 8,8-dioxide (PubChem CID 101161450) has the molecular formula C34H22O2S and a molecular weight of 494.62 g/mol. Its IUPAC name is 3,13-diphenyl-8λ6-thiahexacyclo[13.7.1.02,14.04,12.06,10.019,23]tricosa-1(22),2,4(12),5,10,13,15,17,19(23),20-decaene 8,8-dioxide.
| Compound Name | 3,13-diphenyl-8λ6-thiahexacyclo[13.7.1.02,14.04,12.06,10.019,23]tricosa-1(22),2,4(12),5,10,13,15,17,19(23),20-decaene 8,8-dioxide |
|---|---|
| PubChem CID | 101161450 |
| Molecular Formula | C34H22O2S |
| Molecular Weight | 494.62 g/mol |
| Exact Mass | 494.13 |
| IUPAC Name | 3,13-diphenyl-8λ6-thiahexacyclo[13.7.1.02,14.04,12.06,10.019,23]tricosa-1(22),2,4(12),5,10,13,15,17,19(23),20-decaene 8,8-dioxide |
| SMILES | O=S1(=O)Cc2cc3c(-c4ccccc4)c4c(c(-c5ccccc5)c3cc2C1)-c1cccc2cccc-4c12 |
| InChI | InChI=1S/C34H22O2S/c35-37(36)19-24-17-28-29(18-25(24)20-37)32(23-11-5-2-6-12-23)34-27-16-8-14-21-13-7-15-26(30(21)27)33(34)31(28)22-9-3-1-4-10-22/h1-18H,19-20H2 |
| InChIKey | WUDLHDJTYNVCGD-UHFFFAOYSA-N |
| XLogP | 8.40 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.62 |
| LogP ≤ 5 | 8.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |