C31H25NO2 — CID 101161594
4-[(E)-[(1S,12R,13R,16R)-3,10-dimethoxy-14-pentacyclo[10.4.1.02,11.04,9.013,16]heptadeca-2,4,6,8,10-pentaenylidene]methyl]naphthalene-1-carbonitrile (PubChem CID 101161594) has the molecular formula C31H25NO2 and a molecular weight of 443.55 g/mol. Its IUPAC name is 4-[(E)-[(1S,12R,13R,16R)-3,10-dimethoxy-14-pentacyclo[10.4.1.02,11.04,9.013,16]heptadeca-2,4,6,8,10-pentaenylidene]methyl]naphthalene-1-carbonitrile.
| Compound Name | 4-[(E)-[(1S,12R,13R,16R)-3,10-dimethoxy-14-pentacyclo[10.4.1.02,11.04,9.013,16]heptadeca-2,4,6,8,10-pentaenylidene]methyl]naphthalene-1-carbonitrile |
|---|---|
| PubChem CID | 101161594 |
| Molecular Formula | C31H25NO2 |
| Molecular Weight | 443.55 g/mol |
| Exact Mass | 443.19 |
| IUPAC Name | 4-[(E)-[(1S,12R,13R,16R)-3,10-dimethoxy-14-pentacyclo[10.4.1.02,11.04,9.013,16]heptadeca-2,4,6,8,10-pentaenylidene]methyl]naphthalene-1-carbonitrile |
| SMILES | COc1c2c(c(OC)c3ccccc13)[C@@H]1C[C@H]2[C@H]2C/C(=C\c3ccc(C#N)c4ccccc34)[C@H]21 |
| InChI | InChI=1S/C31H25NO2/c1-33-30-22-9-5-6-10-23(22)31(34-2)29-26-15-25(28(29)30)24-14-19(27(24)26)13-17-11-12-18(16-32)21-8-4-3-7-20(17)21/h3-13,24-27H,14-15H2,1-2H3/b19-13+/t24-,25+,26-,27-/m1/s1 |
| InChIKey | JEWIBVMBVWXEQC-ZGAXXTLWSA-N |
| XLogP | 7.19 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.55 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |