About 6-[(Z)-4-iodobut-3-enyl]-2,2-dimethyl-5,6-dihydrooxasiline
6-[(Z)-4-iodobut-3-enyl]-2,2-dimethyl-5,6-dihydrooxasiline (PubChem CID 101161632) has the molecular formula C10H17IOSi
and a molecular weight of 308.24 g/mol. Its IUPAC name is 6-[(Z)-4-iodobut-3-enyl]-2,2-dimethyl-5,6-dihydrooxasiline.
Molecular Properties
| Compound Name | 6-[(Z)-4-iodobut-3-enyl]-2,2-dimethyl-5,6-dihydrooxasiline |
| PubChem CID | 101161632 |
| Molecular Formula | C10H17IOSi |
| Molecular Weight | 308.24 g/mol |
| Exact Mass | 308.01 |
| IUPAC Name | 6-[(Z)-4-iodobut-3-enyl]-2,2-dimethyl-5,6-dihydrooxasiline |
| SMILES | C[Si]1(C)C=CCC(CC/C=C\I)O1 |
| InChI | InChI=1S/C10H17IOSi/c1-13(2)9-5-7-10(12-13)6-3-4-8-11/h4-5,8-10H,3,6-7H2,1-2H3/b8-4- |
| InChIKey | INSYPLPELWPPEJ-YWEYNIOJSA-N |
| XLogP | 3.80 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.24 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 6-[(Z)-4-iodobut-3-enyl]-2,2-dimethyl-5,6-dihydrooxasiline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[(Z)-4-iodobut-3-enyl]-2,2-dimethyl-5,6-dihydrooxasiline?
The IUPAC name of 6-[(Z)-4-iodobut-3-enyl]-2,2-dimethyl-5,6-dihydrooxasiline (CID 101161632) is 6-[(Z)-4-iodobut-3-enyl]-2,2-dimethyl-5,6-dihydrooxasiline.
What is the SMILES notation for 6-[(Z)-4-iodobut-3-enyl]-2,2-dimethyl-5,6-dihydrooxasiline?
The canonical SMILES for 6-[(Z)-4-iodobut-3-enyl]-2,2-dimethyl-5,6-dihydrooxasiline is C[Si]1(C)C=CCC(CC/C=C\I)O1.
What is the InChIKey of 6-[(Z)-4-iodobut-3-enyl]-2,2-dimethyl-5,6-dihydrooxasiline?
The InChIKey is INSYPLPELWPPEJ-YWEYNIOJSA-N. The full InChI is InChI=1S/C10H17IOSi/c1-13(2)9-5-7-10(12-13)6-3-4-8-11/h4-5,8-10H,3,6-7H2,1-2H3/b8-4-.
What are the key properties of 6-[(Z)-4-iodobut-3-enyl]-2,2-dimethyl-5,6-dihydrooxasiline?
6-[(Z)-4-iodobut-3-enyl]-2,2-dimethyl-5,6-dihydrooxasiline has a molecular weight of 308.24 g/mol, XLogP of 3.80, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[(Z)-4-iodobut-3-enyl]-2,2-dimethyl-5,6-dihydrooxasiline is sourced from PubChem (CID 101161632), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).