About 6-[(Z)-5-iodopent-4-enyl]-2,2-dimethyl-5,6-dihydrooxasiline
6-[(Z)-5-iodopent-4-enyl]-2,2-dimethyl-5,6-dihydrooxasiline (PubChem CID 101161633) has the molecular formula C11H19IOSi
and a molecular weight of 322.26 g/mol. Its IUPAC name is 6-[(Z)-5-iodopent-4-enyl]-2,2-dimethyl-5,6-dihydrooxasiline.
Molecular Properties
| Compound Name | 6-[(Z)-5-iodopent-4-enyl]-2,2-dimethyl-5,6-dihydrooxasiline |
| PubChem CID | 101161633 |
| Molecular Formula | C11H19IOSi |
| Molecular Weight | 322.26 g/mol |
| Exact Mass | 322.02 |
| IUPAC Name | 6-[(Z)-5-iodopent-4-enyl]-2,2-dimethyl-5,6-dihydrooxasiline |
| SMILES | C[Si]1(C)C=CCC(CCC/C=C\I)O1 |
| InChI | InChI=1S/C11H19IOSi/c1-14(2)10-6-8-11(13-14)7-4-3-5-9-12/h5-6,9-11H,3-4,7-8H2,1-2H3/b9-5- |
| InChIKey | BOORYSVQPYQYIM-UITAMQMPSA-N |
| XLogP | 4.19 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.26 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 6-[(Z)-5-iodopent-4-enyl]-2,2-dimethyl-5,6-dihydrooxasiline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[(Z)-5-iodopent-4-enyl]-2,2-dimethyl-5,6-dihydrooxasiline?
The IUPAC name of 6-[(Z)-5-iodopent-4-enyl]-2,2-dimethyl-5,6-dihydrooxasiline (CID 101161633) is 6-[(Z)-5-iodopent-4-enyl]-2,2-dimethyl-5,6-dihydrooxasiline.
What is the SMILES notation for 6-[(Z)-5-iodopent-4-enyl]-2,2-dimethyl-5,6-dihydrooxasiline?
The canonical SMILES for 6-[(Z)-5-iodopent-4-enyl]-2,2-dimethyl-5,6-dihydrooxasiline is C[Si]1(C)C=CCC(CCC/C=C\I)O1.
What is the InChIKey of 6-[(Z)-5-iodopent-4-enyl]-2,2-dimethyl-5,6-dihydrooxasiline?
The InChIKey is BOORYSVQPYQYIM-UITAMQMPSA-N. The full InChI is InChI=1S/C11H19IOSi/c1-14(2)10-6-8-11(13-14)7-4-3-5-9-12/h5-6,9-11H,3-4,7-8H2,1-2H3/b9-5-.
What are the key properties of 6-[(Z)-5-iodopent-4-enyl]-2,2-dimethyl-5,6-dihydrooxasiline?
6-[(Z)-5-iodopent-4-enyl]-2,2-dimethyl-5,6-dihydrooxasiline has a molecular weight of 322.26 g/mol, XLogP of 4.19, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[(Z)-5-iodopent-4-enyl]-2,2-dimethyl-5,6-dihydrooxasiline is sourced from PubChem (CID 101161633), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).