C12H18O3 — CID 101161709
(2R,4aS,8aR)-8a-methyl-2-prop-2-enyl-4a,6,7,8-tetrahydro-4H-pyrano[3,2-b]pyran-3-one (PubChem CID 101161709) has the molecular formula C12H18O3 and a molecular weight of 210.27 g/mol. Its IUPAC name is (2R,4aS,8aR)-8a-methyl-2-prop-2-enyl-4a,6,7,8-tetrahydro-4H-pyrano[3,2-b]pyran-3-one.
| Compound Name | (2R,4aS,8aR)-8a-methyl-2-prop-2-enyl-4a,6,7,8-tetrahydro-4H-pyrano[3,2-b]pyran-3-one |
|---|---|
| PubChem CID | 101161709 |
| Molecular Formula | C12H18O3 |
| Molecular Weight | 210.27 g/mol |
| Exact Mass | 210.13 |
| IUPAC Name | (2R,4aS,8aR)-8a-methyl-2-prop-2-enyl-4a,6,7,8-tetrahydro-4H-pyrano[3,2-b]pyran-3-one |
| SMILES | C=CC[C@H]1O[C@]2(C)CCCO[C@H]2CC1=O |
| InChI | InChI=1S/C12H18O3/c1-3-5-10-9(13)8-11-12(2,15-10)6-4-7-14-11/h3,10-11H,1,4-8H2,2H3/t10-,11+,12-/m1/s1 |
| InChIKey | OFERCWXDGWKPGB-GRYCIOLGSA-N |
| XLogP | 1.86 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.27 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|