C38H52O9Si — CID 101162059
methyl 2-[(1S,3R,5S,6S,7R,8R,10R,12S,14S,15R)-5-(2-oxopropyl)-6,7-bis(phenylmethoxy)-12-triethylsilyl-4,9,13,16-tetraoxatetracyclo[8.6.0.03,8.012,14]hexadecan-15-yl]acetate (PubChem CID 101162059) has the molecular formula C38H52O9Si and a molecular weight of 680.91 g/mol. Its IUPAC name is methyl 2-[(1S,3R,5S,6S,7R,8R,10R,12S,14S,15R)-5-(2-oxopropyl)-6,7-bis(phenylmethoxy)-12-triethylsilyl-4,9,13,16-tetraoxatetracyclo[8.6.0.03,8.012,14]hexadecan-15-yl]acetate.
| Compound Name | methyl 2-[(1S,3R,5S,6S,7R,8R,10R,12S,14S,15R)-5-(2-oxopropyl)-6,7-bis(phenylmethoxy)-12-triethylsilyl-4,9,13,16-tetraoxatetracyclo[8.6.0.03,8.012,14]hexadecan-15-yl]acetate |
|---|---|
| PubChem CID | 101162059 |
| Molecular Formula | C38H52O9Si |
| Molecular Weight | 680.91 g/mol |
| Exact Mass | 680.34 |
| IUPAC Name | methyl 2-[(1S,3R,5S,6S,7R,8R,10R,12S,14S,15R)-5-(2-oxopropyl)-6,7-bis(phenylmethoxy)-12-triethylsilyl-4,9,13,16-tetraoxatetracyclo[8.6.0.03,8.012,14]hexadecan-15-yl]acetate |
| SMILES | CC[Si](CC)(CC)[C@@]12C[C@H]3O[C@H]4[C@H](OCc5ccccc5)[C@@H](OCc5ccccc5)[C@H](CC(C)=O)O[C@@H]4C[C@@H]3O[C@H](CC(=O)OC)[C@@H]1O2 |
| InChI | InChI=1S/C38H52O9Si/c1-6-48(7-2,8-3)38-22-32-28(44-31(37(38)47-38)21-33(40)41-5)20-30-35(46-32)36(43-24-27-17-13-10-14-18-27)34(29(45-30)19-25(4)39)42-23-26-15-11-9-12-16-26/h9-18,28-32,34-37H,6-8,19-24H2,1-5H3/t28-,29-,30+,31+,32+,34-,35+,36+,37-,38-/m0/s1 |
| InChIKey | IUSANPHPPHVVHV-ZHKOCWHYSA-N |
| XLogP | 5.97 |
| TPSA | 102.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.91 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|