C28H40O7 — CID 101162208
(1R,3S,6R,8S,13R,16S,18R,21S,23R,26S,31R,33S)-2,7,12,17,22,27,32-heptaoxaheptacyclo[19.14.0.03,18.06,16.08,13.023,33.026,31]pentatriaconta-9,29-diene (PubChem CID 101162208) has the molecular formula C28H40O7 and a molecular weight of 488.62 g/mol. Its IUPAC name is (1R,3S,6R,8S,13R,16S,18R,21S,23R,26S,31R,33S)-2,7,12,17,22,27,32-heptaoxaheptacyclo[19.14.0.03,18.06,16.08,13.023,33.026,31]pentatriaconta-9,29-diene.
| Compound Name | (1R,3S,6R,8S,13R,16S,18R,21S,23R,26S,31R,33S)-2,7,12,17,22,27,32-heptaoxaheptacyclo[19.14.0.03,18.06,16.08,13.023,33.026,31]pentatriaconta-9,29-diene |
|---|---|
| PubChem CID | 101162208 |
| Molecular Formula | C28H40O7 |
| Molecular Weight | 488.62 g/mol |
| Exact Mass | 488.28 |
| IUPAC Name | (1R,3S,6R,8S,13R,16S,18R,21S,23R,26S,31R,33S)-2,7,12,17,22,27,32-heptaoxaheptacyclo[19.14.0.03,18.06,16.08,13.023,33.026,31]pentatriaconta-9,29-diene |
| SMILES | C1=C[C@H]2O[C@H]3CC[C@H]4O[C@H]5CC[C@H]6O[C@H]7C=CCO[C@@H]7CC[C@@H]6O[C@@H]5CC[C@@H]4O[C@@H]3CC[C@@H]2OC1 |
| InChI | InChI=1S/C28H40O7/c1-3-19-17(29-15-1)5-7-21-23(31-19)9-11-27-25(33-21)13-14-26-28(35-27)12-10-24-22(34-26)8-6-18-20(32-24)4-2-16-30-18/h1-4,17-28H,5-16H2/t17-,18+,19+,20-,21+,22-,23-,24+,25-,26+,27+,28- |
| InChIKey | URSWZLVIDCHXPT-JCFXSKNESA-N |
| XLogP | 3.63 |
| TPSA | 64.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.62 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|