C26H24N4O5 — CID 10116225
2-[3-(5-carbamimidoyl-2H-benzimidazol-2-yl)-5-(3,4-dimethylphenyl)-4-hydroxyphenyl]butanedioic acid (PubChem CID 10116225) has the molecular formula C26H24N4O5 and a molecular weight of 472.50 g/mol. Its IUPAC name is 2-[3-(5-carbamimidoyl-2H-benzimidazol-2-yl)-5-(3,4-dimethylphenyl)-4-hydroxyphenyl]butanedioic acid.
| Compound Name | 2-[3-(5-carbamimidoyl-2H-benzimidazol-2-yl)-5-(3,4-dimethylphenyl)-4-hydroxyphenyl]butanedioic acid |
|---|---|
| PubChem CID | 10116225 |
| Molecular Formula | C26H24N4O5 |
| Molecular Weight | 472.50 g/mol |
| Exact Mass | 472.17 |
| IUPAC Name | 2-[3-(5-carbamimidoyl-2H-benzimidazol-2-yl)-5-(3,4-dimethylphenyl)-4-hydroxyphenyl]butanedioic acid |
| SMILES | [H]/N=C(\N)c1ccc2c(c1)=NC(c1cc(C(CC(=O)O)C(=O)O)cc(-c3ccc(C)c(C)c3)c1O)N=2 |
| InChI | InChI=1S/C26H24N4O5/c1-12-3-4-14(7-13(12)2)17-8-16(18(26(34)35)11-22(31)32)9-19(23(17)33)25-29-20-6-5-15(24(27)28)10-21(20)30-25/h3-10,18,25,33H,11H2,1-2H3,(H3,27,28)(H,31,32)(H,34,35) |
| InChIKey | CLDUFIFLXVWZSI-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 169.42 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.50 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|