About [(1S,2S)-2-(2-bromoethyl)cyclopropyl]methanol
[(1S,2S)-2-(2-bromoethyl)cyclopropyl]methanol (PubChem CID 101162381) has the molecular formula C6H11BrO
and a molecular weight of 179.06 g/mol. Its IUPAC name is [(1S,2S)-2-(2-bromoethyl)cyclopropyl]methanol.
Molecular Properties
| Compound Name | [(1S,2S)-2-(2-bromoethyl)cyclopropyl]methanol |
| PubChem CID | 101162381 |
| Molecular Formula | C6H11BrO |
| Molecular Weight | 179.06 g/mol |
| Exact Mass | 178.00 |
| IUPAC Name | [(1S,2S)-2-(2-bromoethyl)cyclopropyl]methanol |
| SMILES | OC[C@H]1C[C@H]1CCBr |
| InChI | InChI=1S/C6H11BrO/c7-2-1-5-3-6(5)4-8/h5-6,8H,1-4H2/t5-,6-/m1/s1 |
| InChIKey | YWIUPHUHDBXHME-PHDIDXHHSA-N |
| XLogP | 1.40 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.06 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze [(1S,2S)-2-(2-bromoethyl)cyclopropyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1S,2S)-2-(2-bromoethyl)cyclopropyl]methanol?
The IUPAC name of [(1S,2S)-2-(2-bromoethyl)cyclopropyl]methanol (CID 101162381) is [(1S,2S)-2-(2-bromoethyl)cyclopropyl]methanol.
What is the SMILES notation for [(1S,2S)-2-(2-bromoethyl)cyclopropyl]methanol?
The canonical SMILES for [(1S,2S)-2-(2-bromoethyl)cyclopropyl]methanol is OC[C@H]1C[C@H]1CCBr.
What is the InChIKey of [(1S,2S)-2-(2-bromoethyl)cyclopropyl]methanol?
The InChIKey is YWIUPHUHDBXHME-PHDIDXHHSA-N. The full InChI is InChI=1S/C6H11BrO/c7-2-1-5-3-6(5)4-8/h5-6,8H,1-4H2/t5-,6-/m1/s1.
What are the key properties of [(1S,2S)-2-(2-bromoethyl)cyclopropyl]methanol?
[(1S,2S)-2-(2-bromoethyl)cyclopropyl]methanol has a molecular weight of 179.06 g/mol, XLogP of 1.40, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [(1S,2S)-2-(2-bromoethyl)cyclopropyl]methanol is sourced from PubChem (CID 101162381), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).