About (3R,4S)-2,4-dimethyl-6-trimethylsilylhex-5-yn-3-ol
(3R,4S)-2,4-dimethyl-6-trimethylsilylhex-5-yn-3-ol (PubChem CID 101162766) has the molecular formula C11H22OSi
and a molecular weight of 198.38 g/mol. Its IUPAC name is (3R,4S)-2,4-dimethyl-6-trimethylsilylhex-5-yn-3-ol.
Molecular Properties
| Compound Name | (3R,4S)-2,4-dimethyl-6-trimethylsilylhex-5-yn-3-ol |
| PubChem CID | 101162766 |
| Molecular Formula | C11H22OSi |
| Molecular Weight | 198.38 g/mol |
| Exact Mass | 198.14 |
| IUPAC Name | (3R,4S)-2,4-dimethyl-6-trimethylsilylhex-5-yn-3-ol |
| SMILES | CC(C)[C@@H](O)[C@@H](C)C#C[Si](C)(C)C |
| InChI | InChI=1S/C11H22OSi/c1-9(2)11(12)10(3)7-8-13(4,5)6/h9-12H,1-6H3/t10-,11+/m0/s1 |
| InChIKey | ORPXQOYEJFMGGP-WDEREUQCSA-N |
| XLogP | 2.52 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.38 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze (3R,4S)-2,4-dimethyl-6-trimethylsilylhex-5-yn-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R,4S)-2,4-dimethyl-6-trimethylsilylhex-5-yn-3-ol?
The IUPAC name of (3R,4S)-2,4-dimethyl-6-trimethylsilylhex-5-yn-3-ol (CID 101162766) is (3R,4S)-2,4-dimethyl-6-trimethylsilylhex-5-yn-3-ol.
What is the SMILES notation for (3R,4S)-2,4-dimethyl-6-trimethylsilylhex-5-yn-3-ol?
The canonical SMILES for (3R,4S)-2,4-dimethyl-6-trimethylsilylhex-5-yn-3-ol is CC(C)[C@@H](O)[C@@H](C)C#C[Si](C)(C)C.
What is the InChIKey of (3R,4S)-2,4-dimethyl-6-trimethylsilylhex-5-yn-3-ol?
The InChIKey is ORPXQOYEJFMGGP-WDEREUQCSA-N. The full InChI is InChI=1S/C11H22OSi/c1-9(2)11(12)10(3)7-8-13(4,5)6/h9-12H,1-6H3/t10-,11+/m0/s1.
What are the key properties of (3R,4S)-2,4-dimethyl-6-trimethylsilylhex-5-yn-3-ol?
(3R,4S)-2,4-dimethyl-6-trimethylsilylhex-5-yn-3-ol has a molecular weight of 198.38 g/mol, XLogP of 2.52, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3R,4S)-2,4-dimethyl-6-trimethylsilylhex-5-yn-3-ol is sourced from PubChem (CID 101162766), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).