C18H27LiO — CID 101163087
lithium (Z)-5-(3,4-dimethylphenyl)-2,2,4,5-tetramethylhex-3-en-3-olate (PubChem CID 101163087) has the molecular formula C18H27LiO and a molecular weight of 266.35 g/mol. Its IUPAC name is lithium (Z)-5-(3,4-dimethylphenyl)-2,2,4,5-tetramethylhex-3-en-3-olate.
| Compound Name | lithium (Z)-5-(3,4-dimethylphenyl)-2,2,4,5-tetramethylhex-3-en-3-olate |
|---|---|
| PubChem CID | 101163087 |
| Molecular Formula | C18H27LiO |
| Molecular Weight | 266.35 g/mol |
| Exact Mass | 266.22 |
| IUPAC Name | lithium (Z)-5-(3,4-dimethylphenyl)-2,2,4,5-tetramethylhex-3-en-3-olate |
| SMILES | C/C(=C(/[O-])C(C)(C)C)C(C)(C)c1ccc(C)c(C)c1.[Li+] |
| InChI | InChI=1S/C18H28O.Li/c1-12-9-10-15(11-13(12)2)18(7,8)14(3)16(19)17(4,5)6;/h9-11,19H,1-8H3;/q;+1/p-1/b16-14-; |
| InChIKey | SRBXGFVATLDNJV-ULQCMBKMSA-M |
| XLogP | 1.27 |
| TPSA | 23.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.35 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|