C13H12FNO2 — CID 101163567
(9S,12S,14S)-9-fluoro-8-oxa-1-azatetracyclo[10.2.1.02,7.09,14]pentadeca-2,4,6-trien-15-one (PubChem CID 101163567) has the molecular formula C13H12FNO2 and a molecular weight of 233.24 g/mol. Its IUPAC name is (9S,12S,14S)-9-fluoro-8-oxa-1-azatetracyclo[10.2.1.02,7.09,14]pentadeca-2,4,6-trien-15-one.
| Compound Name | (9S,12S,14S)-9-fluoro-8-oxa-1-azatetracyclo[10.2.1.02,7.09,14]pentadeca-2,4,6-trien-15-one |
|---|---|
| PubChem CID | 101163567 |
| Molecular Formula | C13H12FNO2 |
| Molecular Weight | 233.24 g/mol |
| Exact Mass | 233.09 |
| IUPAC Name | (9S,12S,14S)-9-fluoro-8-oxa-1-azatetracyclo[10.2.1.02,7.09,14]pentadeca-2,4,6-trien-15-one |
| SMILES | O=C1[C@H]2CC[C@@]3(F)Oc4ccccc4N1[C@H]3C2 |
| InChI | InChI=1S/C13H12FNO2/c14-13-6-5-8-7-11(13)15(12(8)16)9-3-1-2-4-10(9)17-13/h1-4,8,11H,5-7H2/t8-,11-,13+/m0/s1 |
| InChIKey | VQGNKDBCXKLDLW-LJUAHTATSA-N |
| XLogP | 2.26 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.24 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |