C14H17NS — CID 101163771
(3aR,6aR)-2-(2-methylsulfanylphenyl)-3,3a,4,5,6,6a-hexahydrocyclopenta[b]pyrrole (PubChem CID 101163771) has the molecular formula C14H17NS and a molecular weight of 231.36 g/mol. Its IUPAC name is (3aR,6aR)-2-(2-methylsulfanylphenyl)-3,3a,4,5,6,6a-hexahydrocyclopenta[b]pyrrole.
| Compound Name | (3aR,6aR)-2-(2-methylsulfanylphenyl)-3,3a,4,5,6,6a-hexahydrocyclopenta[b]pyrrole |
|---|---|
| PubChem CID | 101163771 |
| Molecular Formula | C14H17NS |
| Molecular Weight | 231.36 g/mol |
| Exact Mass | 231.11 |
| IUPAC Name | (3aR,6aR)-2-(2-methylsulfanylphenyl)-3,3a,4,5,6,6a-hexahydrocyclopenta[b]pyrrole |
| SMILES | CSc1ccccc1C1=N[C@@H]2CCC[C@@H]2C1 |
| InChI | InChI=1S/C14H17NS/c1-16-14-8-3-2-6-11(14)13-9-10-5-4-7-12(10)15-13/h2-3,6,8,10,12H,4-5,7,9H2,1H3/t10-,12-/m1/s1 |
| InChIKey | KZJPTCFXMPNDDT-ZYHUDNBSSA-N |
| XLogP | 3.77 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.36 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |