C15H20O5 — CID 101163869
diethyl (1R,2R,4S)-2-ethenyl-7-oxobicyclo[2.2.1]heptane-1,4-dicarboxylate (PubChem CID 101163869) has the molecular formula C15H20O5 and a molecular weight of 280.32 g/mol. Its IUPAC name is diethyl (1R,2R,4S)-2-ethenyl-7-oxobicyclo[2.2.1]heptane-1,4-dicarboxylate.
| Compound Name | diethyl (1R,2R,4S)-2-ethenyl-7-oxobicyclo[2.2.1]heptane-1,4-dicarboxylate |
|---|---|
| PubChem CID | 101163869 |
| Molecular Formula | C15H20O5 |
| Molecular Weight | 280.32 g/mol |
| Exact Mass | 280.13 |
| IUPAC Name | diethyl (1R,2R,4S)-2-ethenyl-7-oxobicyclo[2.2.1]heptane-1,4-dicarboxylate |
| SMILES | C=C[C@H]1C[C@@]2(C(=O)OCC)CC[C@]1(C(=O)OCC)C2=O |
| InChI | InChI=1S/C15H20O5/c1-4-10-9-14(12(17)19-5-2)7-8-15(10,11(14)16)13(18)20-6-3/h4,10H,1,5-9H2,2-3H3/t10-,14-,15+/m0/s1 |
| InChIKey | YVKSLHICDXYPOF-NZVBXONLSA-N |
| XLogP | 1.65 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.32 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|