C25H28O3 — CID 101164261
cis-(2R,5S)-2,5-bis[3-(4-methylphenyl)-3-oxopropyl]cyclopentan-1-one (PubChem CID 101164261) has the molecular formula C25H28O3 and a molecular weight of 376.50 g/mol. Its IUPAC name is cis-(2R,5S)-2,5-bis[3-(4-methylphenyl)-3-oxopropyl]cyclopentan-1-one.
| Compound Name | cis-(2R,5S)-2,5-bis[3-(4-methylphenyl)-3-oxopropyl]cyclopentan-1-one |
|---|---|
| PubChem CID | 101164261 |
| Molecular Formula | C25H28O3 |
| Molecular Weight | 376.50 g/mol |
| Exact Mass | 376.20 |
| IUPAC Name | cis-(2R,5S)-2,5-bis[3-(4-methylphenyl)-3-oxopropyl]cyclopentan-1-one |
| SMILES | Cc1ccc(C(=O)CC[C@@H]2CC[C@H](CCC(=O)c3ccc(C)cc3)C2=O)cc1 |
| InChI | InChI=1S/C25H28O3/c1-17-3-7-19(8-4-17)23(26)15-13-21-11-12-22(25(21)28)14-16-24(27)20-9-5-18(2)6-10-20/h3-10,21-22H,11-16H2,1-2H3/t21-,22+ |
| InChIKey | MONYIHCLXXAODK-SZPZYZBQSA-N |
| XLogP | 5.52 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.50 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |