About (6R)-6-phenyl-6-prop-2-enyl-2,3-dihydropyran
(6R)-6-phenyl-6-prop-2-enyl-2,3-dihydropyran (PubChem CID 101164561) has the molecular formula C14H16O
and a molecular weight of 200.28 g/mol. Its IUPAC name is (6R)-6-phenyl-6-prop-2-enyl-2,3-dihydropyran.
Molecular Properties
| Compound Name | (6R)-6-phenyl-6-prop-2-enyl-2,3-dihydropyran |
| PubChem CID | 101164561 |
| Molecular Formula | C14H16O |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.12 |
| IUPAC Name | (6R)-6-phenyl-6-prop-2-enyl-2,3-dihydropyran |
| SMILES | C=CC[C@]1(c2ccccc2)C=CCCO1 |
| InChI | InChI=1S/C14H16O/c1-2-10-14(11-6-7-12-15-14)13-8-4-3-5-9-13/h2-6,8-9,11H,1,7,10,12H2/t14-/m1/s1 |
| InChIKey | DEZUNNSMPWRXEU-CQSZACIVSA-N |
| XLogP | 3.43 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (6R)-6-phenyl-6-prop-2-enyl-2,3-dihydropyran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6R)-6-phenyl-6-prop-2-enyl-2,3-dihydropyran?
The IUPAC name of (6R)-6-phenyl-6-prop-2-enyl-2,3-dihydropyran (CID 101164561) is (6R)-6-phenyl-6-prop-2-enyl-2,3-dihydropyran.
What is the SMILES notation for (6R)-6-phenyl-6-prop-2-enyl-2,3-dihydropyran?
The canonical SMILES for (6R)-6-phenyl-6-prop-2-enyl-2,3-dihydropyran is C=CC[C@]1(c2ccccc2)C=CCCO1.
What is the InChIKey of (6R)-6-phenyl-6-prop-2-enyl-2,3-dihydropyran?
The InChIKey is DEZUNNSMPWRXEU-CQSZACIVSA-N. The full InChI is InChI=1S/C14H16O/c1-2-10-14(11-6-7-12-15-14)13-8-4-3-5-9-13/h2-6,8-9,11H,1,7,10,12H2/t14-/m1/s1.
What are the key properties of (6R)-6-phenyl-6-prop-2-enyl-2,3-dihydropyran?
(6R)-6-phenyl-6-prop-2-enyl-2,3-dihydropyran has a molecular weight of 200.28 g/mol, XLogP of 3.43, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (6R)-6-phenyl-6-prop-2-enyl-2,3-dihydropyran is sourced from PubChem (CID 101164561), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).