C27H31NO2 — CID 101164788
(1R,3S,6R,7S,8R,10R,12S)-7-benzyl-1,11,11-trimethyl-5-phenyl-2-oxa-5-azatetracyclo[6.5.0.03,6.010,12]tridecan-4-one (PubChem CID 101164788) has the molecular formula C27H31NO2 and a molecular weight of 401.55 g/mol. Its IUPAC name is (1R,3S,6R,7S,8R,10R,12S)-7-benzyl-1,11,11-trimethyl-5-phenyl-2-oxa-5-azatetracyclo[6.5.0.03,6.010,12]tridecan-4-one.
| Compound Name | (1R,3S,6R,7S,8R,10R,12S)-7-benzyl-1,11,11-trimethyl-5-phenyl-2-oxa-5-azatetracyclo[6.5.0.03,6.010,12]tridecan-4-one |
|---|---|
| PubChem CID | 101164788 |
| Molecular Formula | C27H31NO2 |
| Molecular Weight | 401.55 g/mol |
| Exact Mass | 401.24 |
| IUPAC Name | (1R,3S,6R,7S,8R,10R,12S)-7-benzyl-1,11,11-trimethyl-5-phenyl-2-oxa-5-azatetracyclo[6.5.0.03,6.010,12]tridecan-4-one |
| SMILES | CC1(C)[C@@H]2C[C@@H]3[C@H](Cc4ccccc4)[C@@H]4[C@H](O[C@]3(C)C[C@@H]21)C(=O)N4c1ccccc1 |
| InChI | InChI=1S/C27H31NO2/c1-26(2)21-15-20-19(14-17-10-6-4-7-11-17)23-24(30-27(20,3)16-22(21)26)25(29)28(23)18-12-8-5-9-13-18/h4-13,19-24H,14-16H2,1-3H3/t19-,20+,21+,22-,23+,24-,27+/m0/s1 |
| InChIKey | WBVYWWIHXIFUAY-XANOKAKVSA-N |
| XLogP | 5.10 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.55 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |