C30H27N3O3 — CID 10116510
N-[(3,4-dimethoxyphenyl)methyl]-10-phenyl-9,10-dihydro-4H-indolizino[6,7-b]indole-3-carboxamide (PubChem CID 10116510) has the molecular formula C30H27N3O3 and a molecular weight of 477.56 g/mol. Its IUPAC name is N-[(3,4-dimethoxyphenyl)methyl]-10-phenyl-9,10-dihydro-4H-indolizino[6,7-b]indole-3-carboxamide.
| Compound Name | N-[(3,4-dimethoxyphenyl)methyl]-10-phenyl-9,10-dihydro-4H-indolizino[6,7-b]indole-3-carboxamide |
|---|---|
| PubChem CID | 10116510 |
| Molecular Formula | C30H27N3O3 |
| Molecular Weight | 477.56 g/mol |
| Exact Mass | 477.21 |
| IUPAC Name | N-[(3,4-dimethoxyphenyl)methyl]-10-phenyl-9,10-dihydro-4H-indolizino[6,7-b]indole-3-carboxamide |
| SMILES | COc1ccc(CNC(=O)c2ccn3c2Cc2c([nH]c4ccccc24)C3c2ccccc2)cc1OC |
| InChI | InChI=1S/C30H27N3O3/c1-35-26-13-12-19(16-27(26)36-2)18-31-30(34)22-14-15-33-25(22)17-23-21-10-6-7-11-24(21)32-28(23)29(33)20-8-4-3-5-9-20/h3-16,29,32H,17-18H2,1-2H3,(H,31,34) |
| InChIKey | DWNMGXFUCWQZNI-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 68.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.56 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|