C12H22O3 — CID 101165465
(2S,3S)-1-[(4S)-2,2-dimethyl-1,3-dioxan-4-yl]-3-methylpent-4-en-2-ol (PubChem CID 101165465) has the molecular formula C12H22O3 and a molecular weight of 214.30 g/mol. Its IUPAC name is (2S,3S)-1-[(4S)-2,2-dimethyl-1,3-dioxan-4-yl]-3-methylpent-4-en-2-ol.
| Compound Name | (2S,3S)-1-[(4S)-2,2-dimethyl-1,3-dioxan-4-yl]-3-methylpent-4-en-2-ol |
|---|---|
| PubChem CID | 101165465 |
| Molecular Formula | C12H22O3 |
| Molecular Weight | 214.30 g/mol |
| Exact Mass | 214.16 |
| IUPAC Name | (2S,3S)-1-[(4S)-2,2-dimethyl-1,3-dioxan-4-yl]-3-methylpent-4-en-2-ol |
| SMILES | C=C[C@H](C)[C@@H](O)C[C@@H]1CCOC(C)(C)O1 |
| InChI | InChI=1S/C12H22O3/c1-5-9(2)11(13)8-10-6-7-14-12(3,4)15-10/h5,9-11,13H,1,6-8H2,2-4H3/t9-,10-,11-/m0/s1 |
| InChIKey | KMRMRCNKNZOJGQ-DCAQKATOSA-N |
| XLogP | 2.10 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.30 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|