About CID 101165480
CID 101165480 (PubChem CID 101165480) has the molecular formula C8H16NO4S
and a molecular weight of 222.29 g/mol.
Molecular Properties
| Compound Name | CID 101165480 |
| PubChem CID | 101165480 |
| Molecular Formula | C8H16NO4S |
| Molecular Weight | 222.29 g/mol |
| Exact Mass | 222.08 |
| IUPAC Name | — |
| SMILES | CC1(C)CCC(C)(CS(=O)(=O)O)N1[O] |
| InChI | InChI=1S/C8H16NO4S/c1-7(2)4-5-8(3,9(7)10)6-14(11,12)13/h4-6H2,1-3H3,(H,11,12,13) |
| InChIKey | PTOVRBROCPAQGD-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 77.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.29 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze CID 101165480 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 101165480?
The IUPAC name of CID 101165480 (CID 101165480) is not available.
What is the SMILES notation for CID 101165480?
The canonical SMILES for CID 101165480 is CC1(C)CCC(C)(CS(=O)(=O)O)N1[O].
What is the InChIKey of CID 101165480?
The InChIKey is PTOVRBROCPAQGD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16NO4S/c1-7(2)4-5-8(3,9(7)10)6-14(11,12)13/h4-6H2,1-3H3,(H,11,12,13).
What are the key properties of CID 101165480?
CID 101165480 has a molecular weight of 222.29 g/mol, XLogP of 0.85, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 101165480 is sourced from PubChem (CID 101165480), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).