About 4-azidonaphthalene-1,8-dicarbonitrile
4-azidonaphthalene-1,8-dicarbonitrile (PubChem CID 101166166) has the molecular formula C12H5N5
and a molecular weight of 219.21 g/mol. Its IUPAC name is 4-azidonaphthalene-1,8-dicarbonitrile.
Molecular Properties
| Compound Name | 4-azidonaphthalene-1,8-dicarbonitrile |
| PubChem CID | 101166166 |
| Molecular Formula | C12H5N5 |
| Molecular Weight | 219.21 g/mol |
| Exact Mass | 219.05 |
| IUPAC Name | 4-azidonaphthalene-1,8-dicarbonitrile |
| SMILES | N#Cc1cccc2c(N=[N+]=[N-])ccc(C#N)c12 |
| InChI | InChI=1S/C12H5N5/c13-6-8-2-1-3-10-11(16-17-15)5-4-9(7-14)12(8)10/h1-5H |
| InChIKey | DYBGQXMUDKIUIN-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 96.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.21 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 4-azidonaphthalene-1,8-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-azidonaphthalene-1,8-dicarbonitrile?
The IUPAC name of 4-azidonaphthalene-1,8-dicarbonitrile (CID 101166166) is 4-azidonaphthalene-1,8-dicarbonitrile.
What is the SMILES notation for 4-azidonaphthalene-1,8-dicarbonitrile?
The canonical SMILES for 4-azidonaphthalene-1,8-dicarbonitrile is N#Cc1cccc2c(N=[N+]=[N-])ccc(C#N)c12.
What is the InChIKey of 4-azidonaphthalene-1,8-dicarbonitrile?
The InChIKey is DYBGQXMUDKIUIN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H5N5/c13-6-8-2-1-3-10-11(16-17-15)5-4-9(7-14)12(8)10/h1-5H.
What are the key properties of 4-azidonaphthalene-1,8-dicarbonitrile?
4-azidonaphthalene-1,8-dicarbonitrile has a molecular weight of 219.21 g/mol, XLogP of 3.52, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-azidonaphthalene-1,8-dicarbonitrile is sourced from PubChem (CID 101166166), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).