About diphenyl-[(2S)-2-[(4R)-4-phenyl-4,5-dihydro-1,3-oxazol-2-yl]pyrrolidin-1-yl]phosphane
diphenyl-[(2S)-2-[(4R)-4-phenyl-4,5-dihydro-1,3-oxazol-2-yl]pyrrolidin-1-yl]phosphane (PubChem CID 101166329) has the molecular formula C25H25N2OP
and a molecular weight of 400.46 g/mol. Its IUPAC name is diphenyl-[(2S)-2-[(4R)-4-phenyl-4,5-dihydro-1,3-oxazol-2-yl]pyrrolidin-1-yl]phosphane.
Molecular Properties
| Compound Name | diphenyl-[(2S)-2-[(4R)-4-phenyl-4,5-dihydro-1,3-oxazol-2-yl]pyrrolidin-1-yl]phosphane |
| PubChem CID | 101166329 |
| Molecular Formula | C25H25N2OP |
| Molecular Weight | 400.46 g/mol |
| Exact Mass | 400.17 |
| IUPAC Name | diphenyl-[(2S)-2-[(4R)-4-phenyl-4,5-dihydro-1,3-oxazol-2-yl]pyrrolidin-1-yl]phosphane |
| SMILES | c1ccc([C@@H]2COC([C@@H]3CCCN3P(c3ccccc3)c3ccccc3)=N2)cc1 |
| InChI | InChI=1S/C25H25N2OP/c1-4-11-20(12-5-1)23-19-28-25(26-23)24-17-10-18-27(24)29(21-13-6-2-7-14-21)22-15-8-3-9-16-22/h1-9,11-16,23-24H,10,17-19H2/t23-,24-/m0/s1 |
| InChIKey | QAKHCVSFJZYUCE-ZEQRLZLVSA-N |
| XLogP | 4.67 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 400.46 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze diphenyl-[(2S)-2-[(4R)-4-phenyl-4,5-dihydro-1,3-oxazol-2-yl]pyrrolidin-1-yl]phosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diphenyl-[(2S)-2-[(4R)-4-phenyl-4,5-dihydro-1,3-oxazol-2-yl]pyrrolidin-1-yl]phosphane?
The IUPAC name of diphenyl-[(2S)-2-[(4R)-4-phenyl-4,5-dihydro-1,3-oxazol-2-yl]pyrrolidin-1-yl]phosphane (CID 101166329) is diphenyl-[(2S)-2-[(4R)-4-phenyl-4,5-dihydro-1,3-oxazol-2-yl]pyrrolidin-1-yl]phosphane.
What is the SMILES notation for diphenyl-[(2S)-2-[(4R)-4-phenyl-4,5-dihydro-1,3-oxazol-2-yl]pyrrolidin-1-yl]phosphane?
The canonical SMILES for diphenyl-[(2S)-2-[(4R)-4-phenyl-4,5-dihydro-1,3-oxazol-2-yl]pyrrolidin-1-yl]phosphane is c1ccc([C@@H]2COC([C@@H]3CCCN3P(c3ccccc3)c3ccccc3)=N2)cc1.
What is the InChIKey of diphenyl-[(2S)-2-[(4R)-4-phenyl-4,5-dihydro-1,3-oxazol-2-yl]pyrrolidin-1-yl]phosphane?
The InChIKey is QAKHCVSFJZYUCE-ZEQRLZLVSA-N. The full InChI is InChI=1S/C25H25N2OP/c1-4-11-20(12-5-1)23-19-28-25(26-23)24-17-10-18-27(24)29(21-13-6-2-7-14-21)22-15-8-3-9-16-22/h1-9,11-16,23-24H,10,17-19H2/t23-,24-/m0/s1.
What are the key properties of diphenyl-[(2S)-2-[(4R)-4-phenyl-4,5-dihydro-1,3-oxazol-2-yl]pyrrolidin-1-yl]phosphane?
diphenyl-[(2S)-2-[(4R)-4-phenyl-4,5-dihydro-1,3-oxazol-2-yl]pyrrolidin-1-yl]phosphane has a molecular weight of 400.46 g/mol, XLogP of 4.67, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for diphenyl-[(2S)-2-[(4R)-4-phenyl-4,5-dihydro-1,3-oxazol-2-yl]pyrrolidin-1-yl]phosphane is sourced from PubChem (CID 101166329), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).