C24H29NO2 — CID 101166481
tert-butyl N-[(1E,6E)-1,7-diphenylhepta-1,6-dien-4-yl]carbamate (PubChem CID 101166481) has the molecular formula C24H29NO2 and a molecular weight of 363.50 g/mol. Its IUPAC name is tert-butyl N-[(1E,6E)-1,7-diphenylhepta-1,6-dien-4-yl]carbamate.
| Compound Name | tert-butyl N-[(1E,6E)-1,7-diphenylhepta-1,6-dien-4-yl]carbamate |
|---|---|
| PubChem CID | 101166481 |
| Molecular Formula | C24H29NO2 |
| Molecular Weight | 363.50 g/mol |
| Exact Mass | 363.22 |
| IUPAC Name | tert-butyl N-[(1E,6E)-1,7-diphenylhepta-1,6-dien-4-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC(C/C=C/c1ccccc1)C/C=C/c1ccccc1 |
| InChI | InChI=1S/C24H29NO2/c1-24(2,3)27-23(26)25-22(18-10-16-20-12-6-4-7-13-20)19-11-17-21-14-8-5-9-15-21/h4-17,22H,18-19H2,1-3H3,(H,25,26)/b16-10+,17-11+ |
| InChIKey | VJAORZMJGKKSOR-OTYYAQKOSA-N |
| XLogP | 6.09 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.50 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |