C27H27BrFNO10 — CID 101166523
(7S,9S)-7-[(2R,4S,5S,6S)-4-amino-5-hydroxy-6-methyloxan-2-yl]oxy-9-(2-bromo-2-fluoroacetyl)-6,9,11-trihydroxy-4-methoxy-8,10-dihydro-7H-tetracene-5,12-dione (PubChem CID 101166523) has the molecular formula C27H27BrFNO10 and a molecular weight of 624.41 g/mol. Its IUPAC name is (7S,9S)-7-[(2R,4S,5S,6S)-4-amino-5-hydroxy-6-methyloxan-2-yl]oxy-9-(2-bromo-2-fluoroacetyl)-6,9,11-trihydroxy-4-methoxy-8,10-dihydro-7H-tetracene-5,12-dione.
| Compound Name | (7S,9S)-7-[(2R,4S,5S,6S)-4-amino-5-hydroxy-6-methyloxan-2-yl]oxy-9-(2-bromo-2-fluoroacetyl)-6,9,11-trihydroxy-4-methoxy-8,10-dihydro-7H-tetracene-5,12-dione |
|---|---|
| PubChem CID | 101166523 |
| Molecular Formula | C27H27BrFNO10 |
| Molecular Weight | 624.41 g/mol |
| Exact Mass | 623.08 |
| IUPAC Name | (7S,9S)-7-[(2R,4S,5S,6S)-4-amino-5-hydroxy-6-methyloxan-2-yl]oxy-9-(2-bromo-2-fluoroacetyl)-6,9,11-trihydroxy-4-methoxy-8,10-dihydro-7H-tetracene-5,12-dione |
| SMILES | COc1cccc2c1C(=O)c1c(O)c3c(c(O)c1C2=O)C[C@@](O)(C(=O)C(F)Br)C[C@@H]3O[C@H]1C[C@H](N)[C@H](O)[C@H](C)O1 |
| InChI | InChI=1S/C27H27BrFNO10/c1-9-20(31)12(30)6-15(39-9)40-14-8-27(37,25(36)26(28)29)7-11-17(14)24(35)19-18(22(11)33)21(32)10-4-3-5-13(38-2)16(10)23(19)34/h3-5,9,12,14-15,20,26,31,33,35,37H,6-8,30H2,1-2H3/t9-,12-,14-,15-,20+,26?,27-/m0/s1 |
| InChIKey | HENWKHNCFUXDRN-OWTWHYCFSA-N |
| XLogP | 1.70 |
| TPSA | 185.84 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.41 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|