About 3-methyl-5-[1-(1,2-oxazol-3-yl)-4-pyridinylidene]-2-sulfanylidene-1,3-thiazolidin-4-one
3-methyl-5-[1-(1,2-oxazol-3-yl)-4-pyridinylidene]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 101166668) has the molecular formula C12H9N3O2S2
and a molecular weight of 291.36 g/mol. Its IUPAC name is 3-methyl-5-[1-(1,2-oxazol-3-yl)-4-pyridinylidene]-2-sulfanylidene-1,3-thiazolidin-4-one.
Molecular Properties
| Compound Name | 3-methyl-5-[1-(1,2-oxazol-3-yl)-4-pyridinylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
| PubChem CID | 101166668 |
| Molecular Formula | C12H9N3O2S2 |
| Molecular Weight | 291.36 g/mol |
| Exact Mass | 291.01 |
| IUPAC Name | 3-methyl-5-[1-(1,2-oxazol-3-yl)-4-pyridinylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | CN1C(=O)C(=C2C=CN(c3ccon3)C=C2)SC1=S |
| InChI | InChI=1S/C12H9N3O2S2/c1-14-11(16)10(19-12(14)18)8-2-5-15(6-3-8)9-4-7-17-13-9/h2-7H,1H3 |
| InChIKey | BBDNIFHVAXHCEV-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 49.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.36 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 3-methyl-5-[1-(1,2-oxazol-3-yl)-4-pyridinylidene]-2-sulfanylidene-1,3-thiazolidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-5-[1-(1,2-oxazol-3-yl)-4-pyridinylidene]-2-sulfanylidene-1,3-thiazolidin-4-one?
The IUPAC name of 3-methyl-5-[1-(1,2-oxazol-3-yl)-4-pyridinylidene]-2-sulfanylidene-1,3-thiazolidin-4-one (CID 101166668) is 3-methyl-5-[1-(1,2-oxazol-3-yl)-4-pyridinylidene]-2-sulfanylidene-1,3-thiazolidin-4-one.
What is the SMILES notation for 3-methyl-5-[1-(1,2-oxazol-3-yl)-4-pyridinylidene]-2-sulfanylidene-1,3-thiazolidin-4-one?
The canonical SMILES for 3-methyl-5-[1-(1,2-oxazol-3-yl)-4-pyridinylidene]-2-sulfanylidene-1,3-thiazolidin-4-one is CN1C(=O)C(=C2C=CN(c3ccon3)C=C2)SC1=S.
What is the InChIKey of 3-methyl-5-[1-(1,2-oxazol-3-yl)-4-pyridinylidene]-2-sulfanylidene-1,3-thiazolidin-4-one?
The InChIKey is BBDNIFHVAXHCEV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9N3O2S2/c1-14-11(16)10(19-12(14)18)8-2-5-15(6-3-8)9-4-7-17-13-9/h2-7H,1H3.
What are the key properties of 3-methyl-5-[1-(1,2-oxazol-3-yl)-4-pyridinylidene]-2-sulfanylidene-1,3-thiazolidin-4-one?
3-methyl-5-[1-(1,2-oxazol-3-yl)-4-pyridinylidene]-2-sulfanylidene-1,3-thiazolidin-4-one has a molecular weight of 291.36 g/mol, XLogP of 2.27, 1 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-5-[1-(1,2-oxazol-3-yl)-4-pyridinylidene]-2-sulfanylidene-1,3-thiazolidin-4-one is sourced from PubChem (CID 101166668), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).