C20H38O4Si2 — CID 101166727
(2E,4S,5S,6E)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]octa-2,6-dienedial (PubChem CID 101166727) has the molecular formula C20H38O4Si2 and a molecular weight of 398.69 g/mol. Its IUPAC name is (2E,4S,5S,6E)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]octa-2,6-dienedial.
| Compound Name | (2E,4S,5S,6E)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]octa-2,6-dienedial |
|---|---|
| PubChem CID | 101166727 |
| Molecular Formula | C20H38O4Si2 |
| Molecular Weight | 398.69 g/mol |
| Exact Mass | 398.23 |
| IUPAC Name | (2E,4S,5S,6E)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]octa-2,6-dienedial |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H](/C=C/C=O)[C@H](/C=C/C=O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C20H38O4Si2/c1-19(2,3)25(7,8)23-17(13-11-15-21)18(14-12-16-22)24-26(9,10)20(4,5)6/h11-18H,1-10H3/b13-11+,14-12+/t17-,18-/m0/s1 |
| InChIKey | CWNDPMOROWOOIL-KGMIGHOGSA-N |
| XLogP | 5.28 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.69 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|