C14H20INO3 — CID 101167141
10-(2-iodophenyl)-1,4,7-trioxa-10-azacyclododecane (PubChem CID 101167141) has the molecular formula C14H20INO3 and a molecular weight of 377.22 g/mol. Its IUPAC name is 10-(2-iodophenyl)-1,4,7-trioxa-10-azacyclododecane.
| Compound Name | 10-(2-iodophenyl)-1,4,7-trioxa-10-azacyclododecane |
|---|---|
| PubChem CID | 101167141 |
| Molecular Formula | C14H20INO3 |
| Molecular Weight | 377.22 g/mol |
| Exact Mass | 377.05 |
| IUPAC Name | 10-(2-iodophenyl)-1,4,7-trioxa-10-azacyclododecane |
| SMILES | Ic1ccccc1N1CCOCCOCCOCC1 |
| InChI | InChI=1S/C14H20INO3/c15-13-3-1-2-4-14(13)16-5-7-17-9-11-19-12-10-18-8-6-16/h1-4H,5-12H2 |
| InChIKey | MNBOXGOIEPUJIF-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.22 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|