C11H11ClIN3O4 — CID 101167340
(2S,3R,4S,5R)-2-(4-chloro-5-iodopyrrolo[2,3-d]pyrimidin-7-yl)oxy-5-methyloxolane-3,4-diol (PubChem CID 101167340) has the molecular formula C11H11ClIN3O4 and a molecular weight of 411.58 g/mol. Its IUPAC name is (2S,3R,4S,5R)-2-(4-chloro-5-iodopyrrolo[2,3-d]pyrimidin-7-yl)oxy-5-methyloxolane-3,4-diol.
| Compound Name | (2S,3R,4S,5R)-2-(4-chloro-5-iodopyrrolo[2,3-d]pyrimidin-7-yl)oxy-5-methyloxolane-3,4-diol |
|---|---|
| PubChem CID | 101167340 |
| Molecular Formula | C11H11ClIN3O4 |
| Molecular Weight | 411.58 g/mol |
| Exact Mass | 410.95 |
| IUPAC Name | (2S,3R,4S,5R)-2-(4-chloro-5-iodopyrrolo[2,3-d]pyrimidin-7-yl)oxy-5-methyloxolane-3,4-diol |
| SMILES | C[C@H]1O[C@@H](On2cc(I)c3c(Cl)ncnc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C11H11ClIN3O4/c1-4-7(17)8(18)11(19-4)20-16-2-5(13)6-9(12)14-3-15-10(6)16/h2-4,7-8,11,17-18H,1H3/t4-,7-,8-,11+/m1/s1 |
| InChIKey | CIMXJNQXYMAERC-QIDLLAIKSA-N |
| XLogP | 0.58 |
| TPSA | 89.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.58 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|