C18H25NO3S — CID 101167589
4-ethenyl-N-[(1S,2R,3S,4R)-3-hydroxy-4,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]benzenesulfonamide (PubChem CID 101167589) has the molecular formula C18H25NO3S and a molecular weight of 335.47 g/mol. Its IUPAC name is 4-ethenyl-N-[(1S,2R,3S,4R)-3-hydroxy-4,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]benzenesulfonamide.
| Compound Name | 4-ethenyl-N-[(1S,2R,3S,4R)-3-hydroxy-4,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]benzenesulfonamide |
|---|---|
| PubChem CID | 101167589 |
| Molecular Formula | C18H25NO3S |
| Molecular Weight | 335.47 g/mol |
| Exact Mass | 335.16 |
| IUPAC Name | 4-ethenyl-N-[(1S,2R,3S,4R)-3-hydroxy-4,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]benzenesulfonamide |
| SMILES | C=Cc1ccc(S(=O)(=O)N[C@@H]2[C@H]3CC[C@@](C)([C@@H]2O)C3(C)C)cc1 |
| InChI | InChI=1S/C18H25NO3S/c1-5-12-6-8-13(9-7-12)23(21,22)19-15-14-10-11-18(4,16(15)20)17(14,2)3/h5-9,14-16,19-20H,1,10-11H2,2-4H3/t14-,15-,16-,18+/m1/s1 |
| InChIKey | JDXZHTSZYQPOFG-KONPQCLYSA-N |
| XLogP | 2.79 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.47 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |