C15H22O4 — CID 101167745
dimethyl (3aR,8aR)-8a-methyl-1,3,3a,6,7,8-hexahydroazulene-2,2-dicarboxylate (PubChem CID 101167745) has the molecular formula C15H22O4 and a molecular weight of 266.34 g/mol. Its IUPAC name is dimethyl (3aR,8aR)-8a-methyl-1,3,3a,6,7,8-hexahydroazulene-2,2-dicarboxylate.
| Compound Name | dimethyl (3aR,8aR)-8a-methyl-1,3,3a,6,7,8-hexahydroazulene-2,2-dicarboxylate |
|---|---|
| PubChem CID | 101167745 |
| Molecular Formula | C15H22O4 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.15 |
| IUPAC Name | dimethyl (3aR,8aR)-8a-methyl-1,3,3a,6,7,8-hexahydroazulene-2,2-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)C[C@@H]2C=CCCC[C@]2(C)C1 |
| InChI | InChI=1S/C15H22O4/c1-14-8-6-4-5-7-11(14)9-15(10-14,12(16)18-2)13(17)19-3/h5,7,11H,4,6,8-10H2,1-3H3/t11-,14+/m0/s1 |
| InChIKey | XGXMBWTWVKWCPN-SMDDNHRTSA-N |
| XLogP | 2.48 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|