C8H10O5 — CID 101168089
methyl (1S,4S,5R,6R)-4,5-dihydroxy-7-oxabicyclo[4.1.0]hept-2-ene-3-carboxylate (PubChem CID 101168089) has the molecular formula C8H10O5 and a molecular weight of 186.16 g/mol. Its IUPAC name is methyl (1S,4S,5R,6R)-4,5-dihydroxy-7-oxabicyclo[4.1.0]hept-2-ene-3-carboxylate.
| Compound Name | methyl (1S,4S,5R,6R)-4,5-dihydroxy-7-oxabicyclo[4.1.0]hept-2-ene-3-carboxylate |
|---|---|
| PubChem CID | 101168089 |
| Molecular Formula | C8H10O5 |
| Molecular Weight | 186.16 g/mol |
| Exact Mass | 186.05 |
| IUPAC Name | methyl (1S,4S,5R,6R)-4,5-dihydroxy-7-oxabicyclo[4.1.0]hept-2-ene-3-carboxylate |
| SMILES | COC(=O)C1=C[C@@H]2O[C@@H]2[C@H](O)[C@H]1O |
| InChI | InChI=1S/C8H10O5/c1-12-8(11)3-2-4-7(13-4)6(10)5(3)9/h2,4-7,9-10H,1H3/t4-,5-,6+,7-/m0/s1 |
| InChIKey | STLRVXFCWLVCRX-YTLHQDLWSA-N |
| XLogP | -1.41 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.16 |
| LogP ≤ 5 | -1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|