C20H40OSi2 — CID 101168207
tert-butyl-[(1S,2R)-1-cyclohexyl-2-methyl-4-trimethylsilylbut-3-ynoxy]-dimethylsilane (PubChem CID 101168207) has the molecular formula C20H40OSi2 and a molecular weight of 352.71 g/mol. Its IUPAC name is tert-butyl-[(1S,2R)-1-cyclohexyl-2-methyl-4-trimethylsilylbut-3-ynoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(1S,2R)-1-cyclohexyl-2-methyl-4-trimethylsilylbut-3-ynoxy]-dimethylsilane |
|---|---|
| PubChem CID | 101168207 |
| Molecular Formula | C20H40OSi2 |
| Molecular Weight | 352.71 g/mol |
| Exact Mass | 352.26 |
| IUPAC Name | tert-butyl-[(1S,2R)-1-cyclohexyl-2-methyl-4-trimethylsilylbut-3-ynoxy]-dimethylsilane |
| SMILES | C[C@H](C#C[Si](C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)C1CCCCC1 |
| InChI | InChI=1S/C20H40OSi2/c1-17(15-16-22(5,6)7)19(18-13-11-10-12-14-18)21-23(8,9)20(2,3)4/h17-19H,10-14H2,1-9H3/t17-,19-/m1/s1 |
| InChIKey | HMDGOTZNDFPRJX-IEBWSBKVSA-N |
| XLogP | 6.47 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.71 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|