C17H36OSi2 — CID 101168208
tert-butyl-[(3S,4R)-2,4-dimethyl-6-trimethylsilylhex-5-yn-3-yl]oxy-dimethylsilane (PubChem CID 101168208) has the molecular formula C17H36OSi2 and a molecular weight of 312.65 g/mol. Its IUPAC name is tert-butyl-[(3S,4R)-2,4-dimethyl-6-trimethylsilylhex-5-yn-3-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(3S,4R)-2,4-dimethyl-6-trimethylsilylhex-5-yn-3-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 101168208 |
| Molecular Formula | C17H36OSi2 |
| Molecular Weight | 312.65 g/mol |
| Exact Mass | 312.23 |
| IUPAC Name | tert-butyl-[(3S,4R)-2,4-dimethyl-6-trimethylsilylhex-5-yn-3-yl]oxy-dimethylsilane |
| SMILES | CC(C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](C)C#C[Si](C)(C)C |
| InChI | InChI=1S/C17H36OSi2/c1-14(2)16(15(3)12-13-19(7,8)9)18-20(10,11)17(4,5)6/h14-16H,1-11H3/t15-,16+/m1/s1 |
| InChIKey | UZUNKDOVNGCDIS-CVEARBPZSA-N |
| XLogP | 5.55 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.65 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|