C52H72N8O2S4 — CID 101168948
8,25-bis(4-phenylmethoxybutyl)-4,6,10,12,21,23,27,29-octazatricyclo[30.2.2.215,18]octatriaconta-1(35),15,17,32(36),33,37-hexaene-5,11,22,28-tetrathione (PubChem CID 101168948) has the molecular formula C52H72N8O2S4 and a molecular weight of 969.47 g/mol. Its IUPAC name is 8,25-bis(4-phenylmethoxybutyl)-4,6,10,12,21,23,27,29-octazatricyclo[30.2.2.215,18]octatriaconta-1(35),15,17,32(36),33,37-hexaene-5,11,22,28-tetrathione.
| Compound Name | 8,25-bis(4-phenylmethoxybutyl)-4,6,10,12,21,23,27,29-octazatricyclo[30.2.2.215,18]octatriaconta-1(35),15,17,32(36),33,37-hexaene-5,11,22,28-tetrathione |
|---|---|
| PubChem CID | 101168948 |
| Molecular Formula | C52H72N8O2S4 |
| Molecular Weight | 969.47 g/mol |
| Exact Mass | 968.47 |
| IUPAC Name | 8,25-bis(4-phenylmethoxybutyl)-4,6,10,12,21,23,27,29-octazatricyclo[30.2.2.215,18]octatriaconta-1(35),15,17,32(36),33,37-hexaene-5,11,22,28-tetrathione |
| SMILES | S=C1NCCc2ccc(cc2)CCNC(=S)NCC(CCCCOCc2ccccc2)CNC(=S)NCCc2ccc(cc2)CCNC(=S)NCC(CCCCOCc2ccccc2)CN1 |
| InChI | InChI=1S/C52H72N8O2S4/c63-49-53-29-25-41-17-21-43(22-18-41)27-31-55-51(65)59-37-48(16-8-10-34-62-40-46-13-5-2-6-14-46)38-60-52(66)56-32-28-44-23-19-42(20-24-44)26-30-54-50(64)58-36-47(35-57-49)15-7-9-33-61-39-45-11-3-1-4-12-45/h1-6,11-14,17-24,47-48H,7-10,15-16,25-40H2,(H2,53,57,63)(H2,54,58,64)(H2,55,59,65)(H2,56,60,66) |
| InChIKey | MXGVRUKJLPHWES-UHFFFAOYSA-N |
| XLogP | 7.43 |
| TPSA | 114.70 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 66 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 969.47 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|