C10H12O3S — CID 101169296
(2S,3S)-2-(benzenesulfonyl)-3-ethyloxirane (PubChem CID 101169296) has the molecular formula C10H12O3S and a molecular weight of 212.27 g/mol. Its IUPAC name is (2S,3S)-2-(benzenesulfonyl)-3-ethyloxirane.
| Compound Name | (2S,3S)-2-(benzenesulfonyl)-3-ethyloxirane |
|---|---|
| PubChem CID | 101169296 |
| Molecular Formula | C10H12O3S |
| Molecular Weight | 212.27 g/mol |
| Exact Mass | 212.05 |
| IUPAC Name | (2S,3S)-2-(benzenesulfonyl)-3-ethyloxirane |
| SMILES | CC[C@@H]1O[C@H]1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C10H12O3S/c1-2-9-10(13-9)14(11,12)8-6-4-3-5-7-8/h3-7,9-10H,2H2,1H3/t9-,10-/m0/s1 |
| InChIKey | RBXBLIZJJFKKTM-UWVGGRQHSA-N |
| XLogP | 1.60 |
| TPSA | 46.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.27 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|